C25H22N4O3 — CID 143675808
N-[4-amino-3-(1,3-oxazole-2-carboximidoyl)phenyl]-2-(4-phenylmethoxyphenyl)acetamide (PubChem CID 143675808) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-[4-amino-3-(1,3-oxazole-2-carboximidoyl)phenyl]-2-(4-phenylmethoxyphenyl)acetamide.
| Compound Name | N-[4-amino-3-(1,3-oxazole-2-carboximidoyl)phenyl]-2-(4-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 143675808 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[4-amino-3-(1,3-oxazole-2-carboximidoyl)phenyl]-2-(4-phenylmethoxyphenyl)acetamide |
| SMILES | [H]/N=C(\c1ncco1)c1cc(NC(=O)Cc2ccc(OCc3ccccc3)cc2)ccc1N |
| InChI | InChI=1S/C25H22N4O3/c26-22-11-8-19(15-21(22)24(27)25-28-12-13-31-25)29-23(30)14-17-6-9-20(10-7-17)32-16-18-4-2-1-3-5-18/h1-13,15,27H,14,16,26H2,(H,29,30)/b27-24- |
| InChIKey | TWLWZJDIDATBCJ-PNHLSOANSA-N |
| XLogP | 4.43 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|