C24H34N2S — CID 143675924
ethane;3-(2-methylpropyl)pyridine;2-[5-(2-methylpropyl)thiophen-2-yl]pyridine (PubChem CID 143675924) has the molecular formula C24H34N2S and a molecular weight of 382.62 g/mol. Its IUPAC name is ethane;3-(2-methylpropyl)pyridine;2-[5-(2-methylpropyl)thiophen-2-yl]pyridine.
| Compound Name | ethane;3-(2-methylpropyl)pyridine;2-[5-(2-methylpropyl)thiophen-2-yl]pyridine |
|---|---|
| PubChem CID | 143675924 |
| Molecular Formula | C24H34N2S |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | ethane;3-(2-methylpropyl)pyridine;2-[5-(2-methylpropyl)thiophen-2-yl]pyridine |
| SMILES | CC.CC(C)Cc1ccc(-c2ccccn2)s1.CC(C)Cc1cccnc1 |
| InChI | InChI=1S/C13H15NS.C9H13N.C2H6/c1-10(2)9-11-6-7-13(15-11)12-5-3-4-8-14-12;1-8(2)6-9-4-3-5-10-7-9;1-2/h3-8,10H,9H2,1-2H3;3-5,7-8H,6H2,1-2H3;1-2H3 |
| InChIKey | OPCVDOIVYKNIGG-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |