C14H17N2+ — CID 174909931
hydron;3-(2-methylpropyl)-5-pyridin-2-ylpyridine (PubChem CID 174909931) has the molecular formula C14H17N2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is hydron;3-(2-methylpropyl)-5-pyridin-2-ylpyridine.
| Compound Name | hydron;3-(2-methylpropyl)-5-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 174909931 |
| Molecular Formula | C14H17N2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | hydron;3-(2-methylpropyl)-5-pyridin-2-ylpyridine |
| SMILES | CC(C)Cc1cncc(-c2ccccn2)c1.[H+] |
| InChI | InChI=1S/C14H16N2/c1-11(2)7-12-8-13(10-15-9-12)14-5-3-4-6-16-14/h3-6,8-11H,7H2,1-2H3/p+1 |
| InChIKey | KCBXJKPYTOAQTF-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |