C19H28N2 — CID 158328245
2-methyl-6-(2-methylpropyl)pyridine;3-(2-methylpropyl)pyridine (PubChem CID 158328245) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-methyl-6-(2-methylpropyl)pyridine;3-(2-methylpropyl)pyridine.
| Compound Name | 2-methyl-6-(2-methylpropyl)pyridine;3-(2-methylpropyl)pyridine |
|---|---|
| PubChem CID | 158328245 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-methyl-6-(2-methylpropyl)pyridine;3-(2-methylpropyl)pyridine |
| SMILES | CC(C)Cc1cccnc1.Cc1cccc(CC(C)C)n1 |
| InChI | InChI=1S/C10H15N.C9H13N/c1-8(2)7-10-6-4-5-9(3)11-10;1-8(2)6-9-4-3-5-10-7-9/h4-6,8H,7H2,1-3H3;3-5,7-8H,6H2,1-2H3 |
| InChIKey | GPRIUZKMPWBZEF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |