C27H39N3 — CID 172607147
2-ethyl-4-propan-2-ylpyridine;3-(2-methylpropyl)pyridine;4-propan-2-ylpyridine (PubChem CID 172607147) has the molecular formula C27H39N3 and a molecular weight of 405.63 g/mol. Its IUPAC name is 2-ethyl-4-propan-2-ylpyridine;3-(2-methylpropyl)pyridine;4-propan-2-ylpyridine.
| Compound Name | 2-ethyl-4-propan-2-ylpyridine;3-(2-methylpropyl)pyridine;4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 172607147 |
| Molecular Formula | C27H39N3 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 2-ethyl-4-propan-2-ylpyridine;3-(2-methylpropyl)pyridine;4-propan-2-ylpyridine |
| SMILES | CC(C)Cc1cccnc1.CC(C)c1ccncc1.CCc1cc(C(C)C)ccn1 |
| InChI | InChI=1S/C10H15N.C9H13N.C8H11N/c1-4-10-7-9(8(2)3)5-6-11-10;1-8(2)6-9-4-3-5-10-7-9;1-7(2)8-3-5-9-6-4-8/h5-8H,4H2,1-3H3;3-5,7-8H,6H2,1-2H3;3-7H,1-2H3 |
| InChIKey | SLRVLWMGOZOWDY-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |