C28H34N4O3S — CID 143676016
benzene;N-[2-(diethylamino)ethyl]-2-sulfanylacetamide;5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 143676016) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is benzene;N-[2-(diethylamino)ethyl]-2-sulfanylacetamide;5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | benzene;N-[2-(diethylamino)ethyl]-2-sulfanylacetamide;5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143676016 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | benzene;N-[2-(diethylamino)ethyl]-2-sulfanylacetamide;5-[2-(3-hydroxyphenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)CS.NC(=O)c1cncc(C#Cc2cccc(O)c2)c1.c1ccccc1 |
| InChI | InChI=1S/C14H10N2O2.C8H18N2OS.C6H6/c15-14(18)12-6-11(8-16-9-12)5-4-10-2-1-3-13(17)7-10;1-3-10(4-2)6-5-9-8(11)7-12;1-2-4-6-5-3-1/h1-3,6-9,17H,(H2,15,18);12H,3-7H2,1-2H3,(H,9,11);1-6H |
| InChIKey | ANWQNSPCDIXCAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|