C32H30N4O3S — CID 167163600
N-[2-[4-(benzylsulfanylcarbamoyl)anilino]ethyl]-N-ethyl-5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carboxamide (PubChem CID 167163600) has the molecular formula C32H30N4O3S and a molecular weight of 550.68 g/mol. Its IUPAC name is N-[2-[4-(benzylsulfanylcarbamoyl)anilino]ethyl]-N-ethyl-5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[4-(benzylsulfanylcarbamoyl)anilino]ethyl]-N-ethyl-5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167163600 |
| Molecular Formula | C32H30N4O3S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | N-[2-[4-(benzylsulfanylcarbamoyl)anilino]ethyl]-N-ethyl-5-[2-(4-hydroxyphenyl)ethynyl]pyridine-3-carboxamide |
| SMILES | CCN(CCNc1ccc(C(=O)NSCc2ccccc2)cc1)C(=O)c1cncc(C#Cc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C32H30N4O3S/c1-2-36(32(39)28-20-26(21-33-22-28)9-8-24-10-16-30(37)17-11-24)19-18-34-29-14-12-27(13-15-29)31(38)35-40-23-25-6-4-3-5-7-25/h3-7,10-17,20-22,34,37H,2,18-19,23H2,1H3,(H,35,38) |
| InChIKey | BDIIXUPMJCCWPB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|