C24H29N — CID 143676570
ethane;ethene;3-(3-methylbuta-1,3-dien-2-yl)-2-(2-methylphenyl)indolizine (PubChem CID 143676570) has the molecular formula C24H29N and a molecular weight of 331.50 g/mol. Its IUPAC name is ethane;ethene;3-(3-methylbuta-1,3-dien-2-yl)-2-(2-methylphenyl)indolizine.
| Compound Name | ethane;ethene;3-(3-methylbuta-1,3-dien-2-yl)-2-(2-methylphenyl)indolizine |
|---|---|
| PubChem CID | 143676570 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | ethane;ethene;3-(3-methylbuta-1,3-dien-2-yl)-2-(2-methylphenyl)indolizine |
| SMILES | C=C.C=C(C)C(=C)c1c(-c2ccccc2C)cc2ccccn12.CC |
| InChI | InChI=1S/C20H19N.C2H6.C2H4/c1-14(2)16(4)20-19(18-11-6-5-9-15(18)3)13-17-10-7-8-12-21(17)20;2*1-2/h5-13H,1,4H2,2-3H3;1-2H3;1-2H2 |
| InChIKey | LHUWZXYOFRTSBG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|