C20H20N2 — CID 143676529
ethene;3-(2-phenylindolizin-3-yl)buta-1,3-dien-2-amine (PubChem CID 143676529) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethene;3-(2-phenylindolizin-3-yl)buta-1,3-dien-2-amine.
| Compound Name | ethene;3-(2-phenylindolizin-3-yl)buta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 143676529 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | ethene;3-(2-phenylindolizin-3-yl)buta-1,3-dien-2-amine |
| SMILES | C=C.C=C(N)C(=C)c1c(-c2ccccc2)cc2ccccn12 |
| InChI | InChI=1S/C18H16N2.C2H4/c1-13(14(2)19)18-17(15-8-4-3-5-9-15)12-16-10-6-7-11-20(16)18;1-2/h3-12H,1-2,19H2;1-2H2 |
| InChIKey | VBBZLNZQNRNKSN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|