C15H26O — CID 143678786
(2E)-2-[(Z)-but-2-enylidene]-3-methylidenecyclohexan-1-one;ethane (PubChem CID 143678786) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-3-methylidenecyclohexan-1-one;ethane.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-3-methylidenecyclohexan-1-one;ethane |
|---|---|
| PubChem CID | 143678786 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-3-methylidenecyclohexan-1-one;ethane |
| SMILES | C=C1CCCC(=O)/C1=C/C=C\C.CC.CC |
| InChI | InChI=1S/C11H14O.2C2H6/c1-3-4-7-10-9(2)6-5-8-11(10)12;2*1-2/h3-4,7H,2,5-6,8H2,1H3;2*1-2H3/b4-3-,10-7+;; |
| InChIKey | AMDNMMSRLSCZOD-PLDSYRIRSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|