C16H16O3 — CID 90666998
2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]cyclohexane-1,3-dione (PubChem CID 90666998) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]cyclohexane-1,3-dione.
| Compound Name | 2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90666998 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(E)-3-(4-methoxyphenyl)prop-2-enylidene]cyclohexane-1,3-dione |
| SMILES | COc1ccc(/C=C/C=C2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C16H16O3/c1-19-13-10-8-12(9-11-13)4-2-5-14-15(17)6-3-7-16(14)18/h2,4-5,8-11H,3,6-7H2,1H3/b4-2+ |
| InChIKey | CCMJEUYIRWYTRH-DUXPYHPUSA-N |
| XLogP | 2.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|