C14H24N2 — CID 143678848
ethane;(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)imidazole (PubChem CID 143678848) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)imidazole.
| Compound Name | ethane;(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)imidazole |
|---|---|
| PubChem CID | 143678848 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;(4E,5E)-1-methyl-4,5-bis(prop-2-enylidene)imidazole |
| SMILES | C=C/C=c1/ncn(C)/c1=C/C=C.CC.CC |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-4-6-9-10(7-5-2)12(3)8-11-9;2*1-2/h4-8H,1-2H2,3H3;2*1-2H3/b9-6+,10-7+;; |
| InChIKey | ZOZDPCCSBPGVHT-OUFZTKPXSA-N |
| XLogP | 2.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |