C10H11N3W — CID 21019641
N,N-dimethyl-N'-(phenyliminomethyl)methanimidamide;tungsten(2+) (PubChem CID 21019641) has the molecular formula C10H11N3W and a molecular weight of 357.06 g/mol. Its IUPAC name is N,N-dimethyl-N'-(phenyliminomethyl)methanimidamide;tungsten(2+).
| Compound Name | N,N-dimethyl-N'-(phenyliminomethyl)methanimidamide;tungsten(2+) |
|---|---|
| PubChem CID | 21019641 |
| Molecular Formula | C10H11N3W |
| Molecular Weight | 357.06 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N,N-dimethyl-N'-(phenyliminomethyl)methanimidamide;tungsten(2+) |
| SMILES | CN(C)/C=N/[C-]=N/c1[c-]cccc1.[W+2] |
| InChI | InChI=1S/C10H11N3.W/c1-13(2)9-11-8-12-10-6-4-3-5-7-10;/h3-6,9H,1-2H3;/q-2;+2/b11-9+; |
| InChIKey | DWEBCJXGHGSYOR-LBEJWNQZSA-N |
| XLogP | 1.61 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.06 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|