About (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+)
(phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) (PubChem CID 20752938) has the molecular formula C11H13N2VW-
and a molecular weight of 408.02 g/mol. Its IUPAC name is (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+).
Molecular Properties
| Compound Name | (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) |
| PubChem CID | 20752938 |
| Molecular Formula | C11H13N2VW- |
| Molecular Weight | 408.02 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) |
| SMILES | [CH2-]CC.[V+2].[W]=C/N=C\[N-]c1c[c-]ccc1 |
| InChI | InChI=1S/C8H6N2.C3H7.V.W/c1-9-7-10-8-5-3-2-4-6-8;1-3-2;;/h1-3,5-7H;1,3H2,2H3;;/q-2;-1;+2; |
| InChIKey | NZMASIDUOQYFDD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.02 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+)?
The IUPAC name of (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) (CID 20752938) is (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+).
What is the SMILES notation for (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+)?
The canonical SMILES for (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) is [CH2-]CC.[V+2].[W]=C/N=C\[N-]c1c[c-]ccc1.
What is the InChIKey of (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+)?
The InChIKey is NZMASIDUOQYFDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C3H7.V.W/c1-9-7-10-8-5-3-2-4-6-8;1-3-2;;/h1-3,5-7H;1,3H2,2H3;;/q-2;-1;+2;.
What are the key properties of (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+)?
(phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) has a molecular weight of 408.02 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (phenylazanidylmethylideneamino)methylidenetungsten;propane;vanadium(2+) is sourced from PubChem (CID 20752938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).