C30H20N2O9S3 — CID 143684082
4-[[14-methyl-8,15-dioxo-16-(3-sulfanylbenzoyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl]amino]benzene-1,3-disulfonic acid (PubChem CID 143684082) has the molecular formula C30H20N2O9S3 and a molecular weight of 648.70 g/mol. Its IUPAC name is 4-[[14-methyl-8,15-dioxo-16-(3-sulfanylbenzoyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl]amino]benzene-1,3-disulfonic acid.
| Compound Name | 4-[[14-methyl-8,15-dioxo-16-(3-sulfanylbenzoyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl]amino]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 143684082 |
| Molecular Formula | C30H20N2O9S3 |
| Molecular Weight | 648.70 g/mol |
| Exact Mass | 648.03 |
| IUPAC Name | 4-[[14-methyl-8,15-dioxo-16-(3-sulfanylbenzoyl)-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl]amino]benzene-1,3-disulfonic acid |
| SMILES | Cn1c(=O)c(C(=O)c2cccc(S)c2)c2c3c(c(Nc4ccc(S(=O)(=O)O)cc4S(=O)(=O)O)ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C30H20N2O9S3/c1-32-22-12-11-21(31-20-10-9-17(43(36,37)38)14-23(20)44(39,40)41)25-26(22)24(18-7-2-3-8-19(18)29(25)34)27(30(32)35)28(33)15-5-4-6-16(42)13-15/h2-14,31,42H,1H3,(H,36,37,38)(H,39,40,41) |
| InChIKey | UFARDQLPBLYOKA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 176.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.70 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|