C39H35N3O9S — CID 58132090
6-[[3-[5-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-2-sulfophenyl]-2-oxopropyl]amino]hexanoic acid (PubChem CID 58132090) has the molecular formula C39H35N3O9S and a molecular weight of 721.79 g/mol. Its IUPAC name is 6-[[3-[5-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-2-sulfophenyl]-2-oxopropyl]amino]hexanoic acid.
| Compound Name | 6-[[3-[5-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-2-sulfophenyl]-2-oxopropyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 58132090 |
| Molecular Formula | C39H35N3O9S |
| Molecular Weight | 721.79 g/mol |
| Exact Mass | 721.21 |
| IUPAC Name | 6-[[3-[5-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]-2-sulfophenyl]-2-oxopropyl]amino]hexanoic acid |
| SMILES | Cn1c(=O)c(C(=O)c2ccccc2)c2c3c(c(Nc4ccc(S(=O)(=O)O)c(CC(=O)CNCCCCCC(=O)O)c4)ccc31)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C39H35N3O9S/c1-42-30-17-16-29(41-25-15-18-31(52(49,50)51)24(20-25)21-26(43)22-40-19-9-3-6-14-32(44)45)34-35(30)33(27-12-7-8-13-28(27)38(34)47)36(39(42)48)37(46)23-10-4-2-5-11-23/h2,4-5,7-8,10-13,15-18,20,40-41H,3,6,9,14,19,21-22H2,1H3,(H,44,45)(H,49,50,51) |
| InChIKey | HRSVULNZAWKFGJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 188.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.79 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|