C32H23N3O4 — CID 11858528
N-[3-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]phenyl]acetamide (PubChem CID 11858528) has the molecular formula C32H23N3O4 and a molecular weight of 513.55 g/mol. Its IUPAC name is N-[3-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 11858528 |
| Molecular Formula | C32H23N3O4 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[3-[(16-benzoyl-14-methyl-8,15-dioxo-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaen-10-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ccc3c4c2C(=O)c2ccccc2-c4c(C(=O)c2ccccc2)c(=O)n3C)c1 |
| InChI | InChI=1S/C32H23N3O4/c1-18(36)33-20-11-8-12-21(17-20)34-24-15-16-25-28-26(22-13-6-7-14-23(22)31(38)27(24)28)29(32(39)35(25)2)30(37)19-9-4-3-5-10-19/h3-17,34H,1-2H3,(H,33,36) |
| InChIKey | SDVJBYPIMVGSKD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|