C16H19N3 — CID 143686503
2-(4-ethylphenyl)-N'-(methylamino)benzenecarboximidamide (PubChem CID 143686503) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N'-(methylamino)benzenecarboximidamide.
| Compound Name | 2-(4-ethylphenyl)-N'-(methylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 143686503 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-(4-ethylphenyl)-N'-(methylamino)benzenecarboximidamide |
| SMILES | CCc1ccc(-c2ccccc2/C(N)=N/NC)cc1 |
| InChI | InChI=1S/C16H19N3/c1-3-12-8-10-13(11-9-12)14-6-4-5-7-15(14)16(17)19-18-2/h4-11,18H,3H2,1-2H3,(H2,17,19) |
| InChIKey | BHGSDVLXMMXCEG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|