C23H33N5 — CID 142875261
N'-(tert-butyldiazenyl)-2-[4-[(3-methylbutan-2-ylamino)methyl]phenyl]benzenecarboximidamide (PubChem CID 142875261) has the molecular formula C23H33N5 and a molecular weight of 379.55 g/mol. Its IUPAC name is N'-(tert-butyldiazenyl)-2-[4-[(3-methylbutan-2-ylamino)methyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-(tert-butyldiazenyl)-2-[4-[(3-methylbutan-2-ylamino)methyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142875261 |
| Molecular Formula | C23H33N5 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | N'-(tert-butyldiazenyl)-2-[4-[(3-methylbutan-2-ylamino)methyl]phenyl]benzenecarboximidamide |
| SMILES | CC(C)C(C)NCc1ccc(-c2ccccc2/C(N)=N/N=N/C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H33N5/c1-16(2)17(3)25-15-18-11-13-19(14-12-18)20-9-7-8-10-21(20)22(24)26-28-27-23(4,5)6/h7-14,16-17,25H,15H2,1-6H3,(H2,24,26,27) |
| InChIKey | MGOIHUGMXGUATG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|