C22H29ClN6O — CID 170149855
2-[4-[[2-butyl-5-chloro-4-(hydroxymethyl)-1,2-dihydroimidazol-3-yl]methyl]phenyl]-N'-hydrazinylbenzenecarboximidamide (PubChem CID 170149855) has the molecular formula C22H29ClN6O and a molecular weight of 428.97 g/mol. Its IUPAC name is 2-[4-[[2-butyl-5-chloro-4-(hydroxymethyl)-1,2-dihydroimidazol-3-yl]methyl]phenyl]-N'-hydrazinylbenzenecarboximidamide.
| Compound Name | 2-[4-[[2-butyl-5-chloro-4-(hydroxymethyl)-1,2-dihydroimidazol-3-yl]methyl]phenyl]-N'-hydrazinylbenzenecarboximidamide |
|---|---|
| PubChem CID | 170149855 |
| Molecular Formula | C22H29ClN6O |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[4-[[2-butyl-5-chloro-4-(hydroxymethyl)-1,2-dihydroimidazol-3-yl]methyl]phenyl]-N'-hydrazinylbenzenecarboximidamide |
| SMILES | CCCCC1NC(Cl)=C(CO)N1Cc1ccc(-c2ccccc2/C(N)=N/NN)cc1 |
| InChI | InChI=1S/C22H29ClN6O/c1-2-3-8-20-26-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22(24)27-28-25/h4-7,9-12,20,26,28,30H,2-3,8,13-14,25H2,1H3,(H2,24,27) |
| InChIKey | IEBMZLOQYHZEOM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 111.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|