C31H44ClN7O8 — CID 143701437
N,N'-diamino-2-[4-[(2-butyl-5-chloro-4-methyl-1,2-dihydroimidazol-3-yl)methyl]phenyl]benzenecarboximidamide;6-nitrooxyhexoxycarbonyloxymethyl formate (PubChem CID 143701437) has the molecular formula C31H44ClN7O8 and a molecular weight of 678.19 g/mol. Its IUPAC name is N,N'-diamino-2-[4-[(2-butyl-5-chloro-4-methyl-1,2-dihydroimidazol-3-yl)methyl]phenyl]benzenecarboximidamide;6-nitrooxyhexoxycarbonyloxymethyl formate.
| Compound Name | N,N'-diamino-2-[4-[(2-butyl-5-chloro-4-methyl-1,2-dihydroimidazol-3-yl)methyl]phenyl]benzenecarboximidamide;6-nitrooxyhexoxycarbonyloxymethyl formate |
|---|---|
| PubChem CID | 143701437 |
| Molecular Formula | C31H44ClN7O8 |
| Molecular Weight | 678.19 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | N,N'-diamino-2-[4-[(2-butyl-5-chloro-4-methyl-1,2-dihydroimidazol-3-yl)methyl]phenyl]benzenecarboximidamide;6-nitrooxyhexoxycarbonyloxymethyl formate |
| SMILES | CCCCC1NC(Cl)=C(C)N1Cc1ccc(-c2ccccc2/C(=N/N)NN)cc1.O=COCOC(=O)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H29ClN6.C9H15NO8/c1-3-4-9-20-26-21(23)15(2)29(20)14-16-10-12-17(13-11-16)18-7-5-6-8-19(18)22(27-24)28-25;11-7-15-8-17-9(12)16-5-3-1-2-4-6-18-10(13)14/h5-8,10-13,20,26H,3-4,9,14,24-25H2,1-2H3,(H,27,28);7H,1-6,8H2 |
| InChIKey | BFAWBHNXHJOZMJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 205.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.19 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|