C21H27ClN6O — CID 169196322
N,N'-diamino-2-[4-[[4-chloro-5-(hydroxymethyl)-2-methylimidazol-1-yl]methyl]phenyl]benzenecarboximidamide;ethane (PubChem CID 169196322) has the molecular formula C21H27ClN6O and a molecular weight of 414.94 g/mol. Its IUPAC name is N,N'-diamino-2-[4-[[4-chloro-5-(hydroxymethyl)-2-methylimidazol-1-yl]methyl]phenyl]benzenecarboximidamide;ethane.
| Compound Name | N,N'-diamino-2-[4-[[4-chloro-5-(hydroxymethyl)-2-methylimidazol-1-yl]methyl]phenyl]benzenecarboximidamide;ethane |
|---|---|
| PubChem CID | 169196322 |
| Molecular Formula | C21H27ClN6O |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N,N'-diamino-2-[4-[[4-chloro-5-(hydroxymethyl)-2-methylimidazol-1-yl]methyl]phenyl]benzenecarboximidamide;ethane |
| SMILES | CC.Cc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2/C(=N/N)NN)cc1 |
| InChI | InChI=1S/C19H21ClN6O.C2H6/c1-12-23-18(20)17(11-27)26(12)10-13-6-8-14(9-7-13)15-4-2-3-5-16(15)19(24-21)25-22;1-2/h2-9,27H,10-11,21-22H2,1H3,(H,24,25);1-2H3 |
| InChIKey | DCJKRQBQCRCVEH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|