C26H30ClN5O5 — CID 143686932
2-[4-[(4-chloro-5-methylimidazol-1-yl)methyl]phenyl]-N'-methyl-N-(methylideneamino)benzenecarboximidamide;propan-2-yloxycarbonyloxymethyl formate (PubChem CID 143686932) has the molecular formula C26H30ClN5O5 and a molecular weight of 528.01 g/mol. Its IUPAC name is 2-[4-[(4-chloro-5-methylimidazol-1-yl)methyl]phenyl]-N'-methyl-N-(methylideneamino)benzenecarboximidamide;propan-2-yloxycarbonyloxymethyl formate.
| Compound Name | 2-[4-[(4-chloro-5-methylimidazol-1-yl)methyl]phenyl]-N'-methyl-N-(methylideneamino)benzenecarboximidamide;propan-2-yloxycarbonyloxymethyl formate |
|---|---|
| PubChem CID | 143686932 |
| Molecular Formula | C26H30ClN5O5 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 2-[4-[(4-chloro-5-methylimidazol-1-yl)methyl]phenyl]-N'-methyl-N-(methylideneamino)benzenecarboximidamide;propan-2-yloxycarbonyloxymethyl formate |
| SMILES | C=NN/C(=N\C)c1ccccc1-c1ccc(Cn2cnc(Cl)c2C)cc1.CC(C)OC(=O)OCOC=O |
| InChI | InChI=1S/C20H20ClN5.C6H10O5/c1-14-19(21)24-13-26(14)12-15-8-10-16(11-9-15)17-6-4-5-7-18(17)20(22-2)25-23-3;1-5(2)11-6(8)10-4-9-3-7/h4-11,13H,3,12H2,1-2H3,(H,22,25);3,5H,4H2,1-2H3 |
| InChIKey | UWCNVCYVAGTZSH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|