C32H39N5O3 — CID 143677502
[[C-[2-[4-[[4-ethyl-6-oxo-5-(1-piperidin-1-ylethenyl)-2-propylpyrimidin-1-yl]methyl]phenyl]phenyl]-N-methylcarbonimidoyl]amino] formate (PubChem CID 143677502) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is [[C-[2-[4-[[4-ethyl-6-oxo-5-(1-piperidin-1-ylethenyl)-2-propylpyrimidin-1-yl]methyl]phenyl]phenyl]-N-methylcarbonimidoyl]amino] formate.
| Compound Name | [[C-[2-[4-[[4-ethyl-6-oxo-5-(1-piperidin-1-ylethenyl)-2-propylpyrimidin-1-yl]methyl]phenyl]phenyl]-N-methylcarbonimidoyl]amino] formate |
|---|---|
| PubChem CID | 143677502 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | [[C-[2-[4-[[4-ethyl-6-oxo-5-(1-piperidin-1-ylethenyl)-2-propylpyrimidin-1-yl]methyl]phenyl]phenyl]-N-methylcarbonimidoyl]amino] formate |
| SMILES | C=C(c1c(CC)nc(CCC)n(Cc2ccc(-c3ccccc3/C(=N/C)NOC=O)cc2)c1=O)N1CCCCC1 |
| InChI | InChI=1S/C32H39N5O3/c1-5-12-29-34-28(6-2)30(23(3)36-19-10-7-11-20-36)32(39)37(29)21-24-15-17-25(18-16-24)26-13-8-9-14-27(26)31(33-4)35-40-22-38/h8-9,13-18,22H,3,5-7,10-12,19-21H2,1-2,4H3,(H,33,35) |
| InChIKey | RLISLXMLFWIZNV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|