C32H36N4O2 — CID 143677449
2-[4-[[4-ethyl-5-(3-ethylphenoxy)-6-oxo-2-propylpyrimidin-1-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide (PubChem CID 143677449) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 2-[4-[[4-ethyl-5-(3-ethylphenoxy)-6-oxo-2-propylpyrimidin-1-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide.
| Compound Name | 2-[4-[[4-ethyl-5-(3-ethylphenoxy)-6-oxo-2-propylpyrimidin-1-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143677449 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 2-[4-[[4-ethyl-5-(3-ethylphenoxy)-6-oxo-2-propylpyrimidin-1-yl]methyl]phenyl]-N'-methylbenzenecarboximidamide |
| SMILES | CCCc1nc(CC)c(Oc2cccc(CC)c2)c(=O)n1Cc1ccc(-c2ccccc2/C(N)=N/C)cc1 |
| InChI | InChI=1S/C32H36N4O2/c1-5-11-29-35-28(7-3)30(38-25-13-10-12-22(6-2)20-25)32(37)36(29)21-23-16-18-24(19-17-23)26-14-8-9-15-27(26)31(33)34-4/h8-10,12-20H,5-7,11,21H2,1-4H3,(H2,33,34) |
| InChIKey | SHNREIMJMVRTHM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|