C30H42FN3O2 — CID 143687083
(E)-N-[2-(butylamino)butyl]-2-[(3Z)-3-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methylcyclohexen-1-yl]-3-methylhex-2-enamide (PubChem CID 143687083) has the molecular formula C30H42FN3O2 and a molecular weight of 495.68 g/mol. Its IUPAC name is (E)-N-[2-(butylamino)butyl]-2-[(3Z)-3-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methylcyclohexen-1-yl]-3-methylhex-2-enamide.
| Compound Name | (E)-N-[2-(butylamino)butyl]-2-[(3Z)-3-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methylcyclohexen-1-yl]-3-methylhex-2-enamide |
|---|---|
| PubChem CID | 143687083 |
| Molecular Formula | C30H42FN3O2 |
| Molecular Weight | 495.68 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (E)-N-[2-(butylamino)butyl]-2-[(3Z)-3-(5-fluoro-2-oxo-1H-indol-3-ylidene)-2-methylcyclohexen-1-yl]-3-methylhex-2-enamide |
| SMILES | CCCCNC(CC)CNC(=O)/C(C1=C(C)/C(=C2\C(=O)Nc3ccc(F)cc32)CCC1)=C(\C)CCC |
| InChI | InChI=1S/C30H42FN3O2/c1-6-9-16-32-22(8-3)18-33-29(35)27(19(4)11-7-2)23-12-10-13-24(20(23)5)28-25-17-21(31)14-15-26(25)34-30(28)36/h14-15,17,22,32H,6-13,16,18H2,1-5H3,(H,33,35)(H,34,36)/b27-19+,28-24- |
| InChIKey | UHNABZYSWQKPHJ-NMDNHZRBSA-N |
| XLogP | 6.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|