C24H39N3O6 — CID 143688986
2-[[1-[2-cyclohexyl-2-(2,2-dimethylpropoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pent-4-enoic acid (PubChem CID 143688986) has the molecular formula C24H39N3O6 and a molecular weight of 465.59 g/mol. Its IUPAC name is 2-[[1-[2-cyclohexyl-2-(2,2-dimethylpropoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pent-4-enoic acid.
| Compound Name | 2-[[1-[2-cyclohexyl-2-(2,2-dimethylpropoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 143688986 |
| Molecular Formula | C24H39N3O6 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 2-[[1-[2-cyclohexyl-2-(2,2-dimethylpropoxycarbonylamino)acetyl]pyrrolidine-2-carbonyl]amino]pent-4-enoic acid |
| SMILES | C=CCC(NC(=O)C1CCCN1C(=O)C(NC(=O)OCC(C)(C)C)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C24H39N3O6/c1-5-10-17(22(30)31)25-20(28)18-13-9-14-27(18)21(29)19(16-11-7-6-8-12-16)26-23(32)33-15-24(2,3)4/h5,16-19H,1,6-15H2,2-4H3,(H,25,28)(H,26,32)(H,30,31) |
| InChIKey | HZCKEPZNUWUIEL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|