C25H43BN2O4 — CID 143689918
N-[(E)-8-methoxy-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)oct-6-enyl]-1-methylpyrrolidine-2-carboxamide (PubChem CID 143689918) has the molecular formula C25H43BN2O4 and a molecular weight of 446.44 g/mol. Its IUPAC name is N-[(E)-8-methoxy-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)oct-6-enyl]-1-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[(E)-8-methoxy-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)oct-6-enyl]-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143689918 |
| Molecular Formula | C25H43BN2O4 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | N-[(E)-8-methoxy-1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)oct-6-enyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES | COC/C=C/CCCCC(NC(=O)C1CCCN1C)B1OC2CC3CC(C3(C)C)C2(C)O1 |
| InChI | InChI=1S/C25H43BN2O4/c1-24(2)18-16-20(24)25(3)21(17-18)31-26(32-25)22(13-9-7-6-8-10-15-30-5)27-23(29)19-12-11-14-28(19)4/h8,10,18-22H,6-7,9,11-17H2,1-5H3,(H,27,29)/b10-8+ |
| InChIKey | ASRPVBXPVHVJIV-CSKARUKUSA-N |
| XLogP | 3.60 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|