C32H54BN3O6 — CID 143689937
tert-butyl N-[(3S)-2,15-dioxo-13-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate (PubChem CID 143689937) has the molecular formula C32H54BN3O6 and a molecular weight of 587.61 g/mol. Its IUPAC name is tert-butyl N-[(3S)-2,15-dioxo-13-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-2,15-dioxo-13-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
|---|---|
| PubChem CID | 143689937 |
| Molecular Formula | C32H54BN3O6 |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.41 |
| IUPAC Name | tert-butyl N-[(3S)-2,15-dioxo-13-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,14-diazabicyclo[14.3.0]nonadecan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCCCCCCC(B2OC3CC4CC(C4(C)C)C3(C)O2)NC(=O)C2CCCN2C1=O |
| InChI | InChI=1S/C32H54BN3O6/c1-30(2,3)40-29(39)34-22-15-12-10-8-7-9-11-13-17-26(35-27(37)23-16-14-18-36(23)28(22)38)33-41-25-20-21-19-24(31(21,4)5)32(25,6)42-33/h21-26H,7-20H2,1-6H3,(H,34,39)(H,35,37)/t21?,22-,23?,24?,25?,26?,32?/m0/s1 |
| InChIKey | LOQSCDGYNXFDIX-YBPCEAIMSA-N |
| XLogP | 5.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|