C36H53BN4O6 — CID 70300266
[(13R,18R)-3-methyl-2,15-dioxo-13-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1,3,14-triazabicyclo[14.3.0]nonadecan-18-yl] 1,3-dihydroisoindole-2-carboxylate (PubChem CID 70300266) has the molecular formula C36H53BN4O6 and a molecular weight of 648.65 g/mol. Its IUPAC name is [(13R,18R)-3-methyl-2,15-dioxo-13-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1,3,14-triazabicyclo[14.3.0]nonadecan-18-yl] 1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(13R,18R)-3-methyl-2,15-dioxo-13-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1,3,14-triazabicyclo[14.3.0]nonadecan-18-yl] 1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 70300266 |
| Molecular Formula | C36H53BN4O6 |
| Molecular Weight | 648.65 g/mol |
| Exact Mass | 648.41 |
| IUPAC Name | [(13R,18R)-3-methyl-2,15-dioxo-13-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-1,3,14-triazabicyclo[14.3.0]nonadecan-18-yl] 1,3-dihydroisoindole-2-carboxylate |
| SMILES | CN1CCCCCCCCC[C@@H](B2OC3C[C@H]4C[C@H](C4(C)C)[C@@]3(C)O2)NC(=O)C2C[C@@H](OC(=O)N3Cc4ccccc4C3)CN2C1=O |
| InChI | InChI=1S/C36H53BN4O6/c1-35(2)26-18-29(35)36(3)30(19-26)46-37(47-36)31-16-10-8-6-5-7-9-13-17-39(4)33(43)41-23-27(20-28(41)32(42)38-31)45-34(44)40-21-24-14-11-12-15-25(24)22-40/h11-12,14-15,26-31H,5-10,13,16-23H2,1-4H3,(H,38,42)/t26-,27-,28?,29-,30?,31+,36-/m1/s1 |
| InChIKey | BTUGAAWQMHEXIP-LBGVZKQFSA-N |
| XLogP | 5.52 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.65 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|