C31H52BN3O6Y-2 — CID 59320103
tert-butyl N-[15-methanidyl-2,12-dioxo-10-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,11-diazabicyclo[11.3.0]hexadecan-3-yl]carbamate;carbanide;yttrium (PubChem CID 59320103) has the molecular formula C31H52BN3O6Y-2 and a molecular weight of 662.49 g/mol. Its IUPAC name is tert-butyl N-[15-methanidyl-2,12-dioxo-10-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,11-diazabicyclo[11.3.0]hexadecan-3-yl]carbamate;carbanide;yttrium.
| Compound Name | tert-butyl N-[15-methanidyl-2,12-dioxo-10-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,11-diazabicyclo[11.3.0]hexadecan-3-yl]carbamate;carbanide;yttrium |
|---|---|
| PubChem CID | 59320103 |
| Molecular Formula | C31H52BN3O6Y-2 |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | tert-butyl N-[15-methanidyl-2,12-dioxo-10-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)-1,11-diazabicyclo[11.3.0]hexadecan-3-yl]carbamate;carbanide;yttrium |
| SMILES | [CH2-]C1CC2C(=O)NC(B3OC4CC5CC(C5(C)C)C4(C)O3)CCCCCCC(NC(=O)OC(C)(C)C)C(=O)N2C1.[CH3-].[Y] |
| InChI | InChI=1S/C30H49BN3O6.CH3.Y/c1-18-14-21-25(35)33-24(31-39-23-16-19-15-22(29(19,5)6)30(23,7)40-31)13-11-9-8-10-12-20(26(36)34(21)17-18)32-27(37)38-28(2,3)4;;/h18-24H,1,8-17H2,2-7H3,(H,32,37)(H,33,35);1H3;/q2*-1; |
| InChIKey | NEWRCRFNUVIWBG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|