About 1-benzofuran-2-yl ethanesulfonate
1-benzofuran-2-yl ethanesulfonate (PubChem CID 143690561) has the molecular formula C10H10O4S
and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-benzofuran-2-yl ethanesulfonate.
Molecular Properties
| Compound Name | 1-benzofuran-2-yl ethanesulfonate |
| PubChem CID | 143690561 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1-benzofuran-2-yl ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cc2ccccc2o1 |
| InChI | InChI=1S/C10H10O4S/c1-2-15(11,12)14-10-7-8-5-3-4-6-9(8)13-10/h3-7H,2H2,1H3 |
| InChIKey | DFKKMLUSZGYCKX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-2-yl ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-yl ethanesulfonate?
The IUPAC name of 1-benzofuran-2-yl ethanesulfonate (CID 143690561) is 1-benzofuran-2-yl ethanesulfonate.
What is the SMILES notation for 1-benzofuran-2-yl ethanesulfonate?
The canonical SMILES for 1-benzofuran-2-yl ethanesulfonate is CCS(=O)(=O)Oc1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-yl ethanesulfonate?
The InChIKey is DFKKMLUSZGYCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4S/c1-2-15(11,12)14-10-7-8-5-3-4-6-9(8)13-10/h3-7H,2H2,1H3.
What are the key properties of 1-benzofuran-2-yl ethanesulfonate?
1-benzofuran-2-yl ethanesulfonate has a molecular weight of 226.25 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-yl ethanesulfonate is sourced from PubChem (CID 143690561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).