C14H12F3NO5S — CID 122472899
[(E)-[2,2,2-trifluoro-1-(2-oxochromen-3-yl)ethylidene]amino] propane-1-sulfonate (PubChem CID 122472899) has the molecular formula C14H12F3NO5S and a molecular weight of 363.31 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-(2-oxochromen-3-yl)ethylidene]amino] propane-1-sulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-(2-oxochromen-3-yl)ethylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 122472899 |
| Molecular Formula | C14H12F3NO5S |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-(2-oxochromen-3-yl)ethylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(\c1cc2ccccc2oc1=O)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO5S/c1-2-7-24(20,21)23-18-12(14(15,16)17)10-8-9-5-3-4-6-11(9)22-13(10)19/h3-6,8H,2,7H2,1H3/b18-12+ |
| InChIKey | UMPFWRXEIDHZML-LDADJPATSA-N |
| XLogP | 2.82 |
| TPSA | 85.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|