C21H21NO6S — CID 134166106
[(Z)-1-[7-(hydroxymethyl)-2-oxo-4-phenylchromen-3-yl]ethylideneamino] propane-1-sulfonate (PubChem CID 134166106) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is [(Z)-1-[7-(hydroxymethyl)-2-oxo-4-phenylchromen-3-yl]ethylideneamino] propane-1-sulfonate.
| Compound Name | [(Z)-1-[7-(hydroxymethyl)-2-oxo-4-phenylchromen-3-yl]ethylideneamino] propane-1-sulfonate |
|---|---|
| PubChem CID | 134166106 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [(Z)-1-[7-(hydroxymethyl)-2-oxo-4-phenylchromen-3-yl]ethylideneamino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(/C)c1c(-c2ccccc2)c2ccc(CO)cc2oc1=O |
| InChI | InChI=1S/C21H21NO6S/c1-3-11-29(25,26)28-22-14(2)19-20(16-7-5-4-6-8-16)17-10-9-15(13-23)12-18(17)27-21(19)24/h4-10,12,23H,3,11,13H2,1-2H3/b22-14- |
| InChIKey | OHHLCBPEYIWJLT-HMAPJEAMSA-N |
| XLogP | 3.43 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|