C21H18F3NO6S — CID 122472910
[(E)-[2,2,2-trifluoro-1-(7-methoxy-2-oxo-4-phenylchromen-3-yl)ethylidene]amino] propane-1-sulfonate (PubChem CID 122472910) has the molecular formula C21H18F3NO6S and a molecular weight of 469.44 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-(7-methoxy-2-oxo-4-phenylchromen-3-yl)ethylidene]amino] propane-1-sulfonate.
| Compound Name | [(E)-[2,2,2-trifluoro-1-(7-methoxy-2-oxo-4-phenylchromen-3-yl)ethylidene]amino] propane-1-sulfonate |
|---|---|
| PubChem CID | 122472910 |
| Molecular Formula | C21H18F3NO6S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-(7-methoxy-2-oxo-4-phenylchromen-3-yl)ethylidene]amino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)O/N=C(\c1c(-c2ccccc2)c2ccc(OC)cc2oc1=O)C(F)(F)F |
| InChI | InChI=1S/C21H18F3NO6S/c1-3-11-32(27,28)31-25-19(21(22,23)24)18-17(13-7-5-4-6-8-13)15-10-9-14(29-2)12-16(15)30-20(18)26/h4-10,12H,3,11H2,1-2H3/b25-19+ |
| InChIKey | YWMDCCJGFAAFIW-NCELDCMTSA-N |
| XLogP | 4.49 |
| TPSA | 95.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|