About ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine
ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine (PubChem CID 143692371) has the molecular formula C23H39NO
and a molecular weight of 345.57 g/mol. Its IUPAC name is ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine.
Molecular Properties
| Compound Name | ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine |
| PubChem CID | 143692371 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine |
| SMILES | C/C=C(\C=C/CC)c1ccc(OC2CCN(C)CC2)cc1.CC.CC |
| InChI | InChI=1S/C19H27NO.2C2H6/c1-4-6-7-16(5-2)17-8-10-18(11-9-17)21-19-12-14-20(3)15-13-19;2*1-2/h5-11,19H,4,12-15H2,1-3H3;2*1-2H3/b7-6-,16-5+;; |
| InChIKey | JOOMWUAHEFIAJY-WVSREUJGSA-N |
| XLogP | 6.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine?
The IUPAC name of ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine (CID 143692371) is ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine.
What is the SMILES notation for ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine?
The canonical SMILES for ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine is C/C=C(\C=C/CC)c1ccc(OC2CCN(C)CC2)cc1.CC.CC.
What is the InChIKey of ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine?
The InChIKey is JOOMWUAHEFIAJY-WVSREUJGSA-N. The full InChI is InChI=1S/C19H27NO.2C2H6/c1-4-6-7-16(5-2)17-8-10-18(11-9-17)21-19-12-14-20(3)15-13-19;2*1-2/h5-11,19H,4,12-15H2,1-3H3;2*1-2H3/b7-6-,16-5+;;.
What are the key properties of ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine?
ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine has a molecular weight of 345.57 g/mol, XLogP of 6.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine is sourced from PubChem (CID 143692371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).