C23H39NO — CID 143692371
ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine (PubChem CID 143692371) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine.
| Compound Name | ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine |
|---|---|
| PubChem CID | 143692371 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | ethane;4-[4-[(2E,4Z)-hepta-2,4-dien-3-yl]phenoxy]-1-methylpiperidine |
| SMILES | C/C=C(\C=C/CC)c1ccc(OC2CCN(C)CC2)cc1.CC.CC |
| InChI | InChI=1S/C19H27NO.2C2H6/c1-4-6-7-16(5-2)17-8-10-18(11-9-17)21-19-12-14-20(3)15-13-19;2*1-2/h5-11,19H,4,12-15H2,1-3H3;2*1-2H3/b7-6-,16-5+;; |
| InChIKey | JOOMWUAHEFIAJY-WVSREUJGSA-N |
| XLogP | 6.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|