C21H26O3S — CID 143692432
2-(hydroxymethyl)-6-[2-hydroxy-4-methyl-5-[(4-methylphenyl)methyl]phenyl]thian-4-ol (PubChem CID 143692432) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[2-hydroxy-4-methyl-5-[(4-methylphenyl)methyl]phenyl]thian-4-ol.
| Compound Name | 2-(hydroxymethyl)-6-[2-hydroxy-4-methyl-5-[(4-methylphenyl)methyl]phenyl]thian-4-ol |
|---|---|
| PubChem CID | 143692432 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-(hydroxymethyl)-6-[2-hydroxy-4-methyl-5-[(4-methylphenyl)methyl]phenyl]thian-4-ol |
| SMILES | Cc1ccc(Cc2cc(C3CC(O)CC(CO)S3)c(O)cc2C)cc1 |
| InChI | InChI=1S/C21H26O3S/c1-13-3-5-15(6-4-13)8-16-9-19(20(24)7-14(16)2)21-11-17(23)10-18(12-22)25-21/h3-7,9,17-18,21-24H,8,10-12H2,1-2H3 |
| InChIKey | OEEIOLUUTCRJIN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |