C17H18F3N2O3+ — CID 143692588
[3-[2,3-dimethyl-4-oxo-7-(trifluoromethyl)-5H-pyrrolo[1,2-a]quinoxalin-1-yl]-1-hydroxypropyl]oxidanium (PubChem CID 143692588) has the molecular formula C17H18F3N2O3+ and a molecular weight of 355.34 g/mol. Its IUPAC name is [3-[2,3-dimethyl-4-oxo-7-(trifluoromethyl)-5H-pyrrolo[1,2-a]quinoxalin-1-yl]-1-hydroxypropyl]oxidanium.
| Compound Name | [3-[2,3-dimethyl-4-oxo-7-(trifluoromethyl)-5H-pyrrolo[1,2-a]quinoxalin-1-yl]-1-hydroxypropyl]oxidanium |
|---|---|
| PubChem CID | 143692588 |
| Molecular Formula | C17H18F3N2O3+ |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | [3-[2,3-dimethyl-4-oxo-7-(trifluoromethyl)-5H-pyrrolo[1,2-a]quinoxalin-1-yl]-1-hydroxypropyl]oxidanium |
| SMILES | Cc1c(C)c2c(=O)[nH]c3cc(C(F)(F)F)ccc3n2c1CCC(O)[OH2+] |
| InChI | InChI=1S/C17H17F3N2O3/c1-8-9(2)15-16(25)21-11-7-10(17(18,19)20)3-4-13(11)22(15)12(8)5-6-14(23)24/h3-4,7,14,23-24H,5-6H2,1-2H3,(H,21,25)/p+1 |
| InChIKey | BKJMYINJPOPWNU-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|