C9H10N2S — CID 143693644
N,2-dimethylthieno[3,2-b]pyridin-3-amine (PubChem CID 143693644) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is N,2-dimethylthieno[3,2-b]pyridin-3-amine.
| Compound Name | N,2-dimethylthieno[3,2-b]pyridin-3-amine |
|---|---|
| PubChem CID | 143693644 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | N,2-dimethylthieno[3,2-b]pyridin-3-amine |
| SMILES | CNc1c(C)sc2cccnc12 |
| InChI | InChI=1S/C9H10N2S/c1-6-8(10-2)9-7(12-6)4-3-5-11-9/h3-5,10H,1-2H3 |
| InChIKey | PRZQRWXPYXXJAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |