About N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane
N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane (PubChem CID 143695836) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane.
Molecular Properties
| Compound Name | N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane |
| PubChem CID | 143695836 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane |
| SMILES | CC.CC/C(=N\C=C(C)C)N(CC)C1CC1 |
| InChI | InChI=1S/C12H22N2.C2H6/c1-5-12(13-9-10(3)4)14(6-2)11-7-8-11;1-2/h9,11H,5-8H2,1-4H3;1-2H3/b13-12+; |
| InChIKey | RXYYAKDWIVMPIU-UEIGIMKUSA-N |
| XLogP | 4.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane?
The IUPAC name of N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane (CID 143695836) is N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane.
What is the SMILES notation for N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane?
The canonical SMILES for N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane is CC.CC/C(=N\C=C(C)C)N(CC)C1CC1.
What is the InChIKey of N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane?
The InChIKey is RXYYAKDWIVMPIU-UEIGIMKUSA-N. The full InChI is InChI=1S/C12H22N2.C2H6/c1-5-12(13-9-10(3)4)14(6-2)11-7-8-11;1-2/h9,11H,5-8H2,1-4H3;1-2H3/b13-12+;.
What are the key properties of N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane?
N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane has a molecular weight of 224.39 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-ethyl-N'-(2-methylprop-1-enyl)propanimidamide;ethane is sourced from PubChem (CID 143695836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).