C30H29Cl2N5O2 — CID 143696587
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-5,7-dichloro-N-(4-methylphenyl)quinolin-8-amine;methanediol (PubChem CID 143696587) has the molecular formula C30H29Cl2N5O2 and a molecular weight of 562.50 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-5,7-dichloro-N-(4-methylphenyl)quinolin-8-amine;methanediol.
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-5,7-dichloro-N-(4-methylphenyl)quinolin-8-amine;methanediol |
|---|---|
| PubChem CID | 143696587 |
| Molecular Formula | C30H29Cl2N5O2 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-5,7-dichloro-N-(4-methylphenyl)quinolin-8-amine;methanediol |
| SMILES | Cc1ccc(Nc2c(Cl)cc(Cl)c3ccc(CN(Cc4ccccn4)Cc4ccccn4)nc23)cc1.OCO |
| InChI | InChI=1S/C29H25Cl2N5.CH4O2/c1-20-8-10-21(11-9-20)34-29-27(31)16-26(30)25-13-12-24(35-28(25)29)19-36(17-22-6-2-4-14-32-22)18-23-7-3-5-15-33-23;2-1-3/h2-16,34H,17-19H2,1H3;2-3H,1H2 |
| InChIKey | KFQWUJNQNQXKTA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|