C22H18F3N3O2 — CID 143697863
3-[4-[5-[4-ethyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal (PubChem CID 143697863) has the molecular formula C22H18F3N3O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-[4-[5-[4-ethyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal.
| Compound Name | 3-[4-[5-[4-ethyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal |
|---|---|
| PubChem CID | 143697863 |
| Molecular Formula | C22H18F3N3O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-[4-[5-[4-ethyl-3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]propanal |
| SMILES | CCc1ccc(-c2nc(-c3cccc4c3ccn4CCC=O)no2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H18F3N3O2/c1-2-14-7-8-15(13-18(14)22(23,24)25)21-26-20(27-30-21)17-5-3-6-19-16(17)9-11-28(19)10-4-12-29/h3,5-9,11-13H,2,4,10H2,1H3 |
| InChIKey | MPORMQKKIRFCEU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|