C26H29N3O2 — CID 143697882
4-[4-[5-[3-ethyl-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butanal (PubChem CID 143697882) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-[4-[5-[3-ethyl-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butanal.
| Compound Name | 4-[4-[5-[3-ethyl-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butanal |
|---|---|
| PubChem CID | 143697882 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 4-[4-[5-[3-ethyl-4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]indol-1-yl]butanal |
| SMILES | CCc1cc(-c2nc(-c3cccc4c3ccn4CCCC=O)no2)ccc1CC(C)C |
| InChI | InChI=1S/C26H29N3O2/c1-4-19-17-21(11-10-20(19)16-18(2)3)26-27-25(28-31-26)23-8-7-9-24-22(23)12-14-29(24)13-5-6-15-30/h7-12,14-15,17-18H,4-6,13,16H2,1-3H3 |
| InChIKey | CXZGNZHRWQARFB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|