C29H33N5O7 — CID 143698248
ethyl 1-[(4-methoxyphenyl)methyl]-4-[2-[[(4-methylphenoxy)amino]peroxymethyl]morpholin-4-yl]pyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 143698248) has the molecular formula C29H33N5O7 and a molecular weight of 563.61 g/mol. Its IUPAC name is ethyl 1-[(4-methoxyphenyl)methyl]-4-[2-[[(4-methylphenoxy)amino]peroxymethyl]morpholin-4-yl]pyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 1-[(4-methoxyphenyl)methyl]-4-[2-[[(4-methylphenoxy)amino]peroxymethyl]morpholin-4-yl]pyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 143698248 |
| Molecular Formula | C29H33N5O7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | ethyl 1-[(4-methoxyphenyl)methyl]-4-[2-[[(4-methylphenoxy)amino]peroxymethyl]morpholin-4-yl]pyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(cnn2Cc2ccc(OC)cc2)c1N1CCOC(COONOc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C29H33N5O7/c1-4-37-29(35)26-15-30-28-25(16-31-34(28)17-21-7-11-22(36-3)12-8-21)27(26)33-13-14-38-24(18-33)19-39-41-32-40-23-9-5-20(2)6-10-23/h5-12,15-16,24,32H,4,13-14,17-19H2,1-3H3 |
| InChIKey | NOBPPNNYGBCSKK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|