C14H23N — CID 143699429
ethane;(3E)-2,2,6-trimethyl-1-azacyclodeca-3,7,8,10-tetraene (PubChem CID 143699429) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is ethane;(3E)-2,2,6-trimethyl-1-azacyclodeca-3,7,8,10-tetraene.
| Compound Name | ethane;(3E)-2,2,6-trimethyl-1-azacyclodeca-3,7,8,10-tetraene |
|---|---|
| PubChem CID | 143699429 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | ethane;(3E)-2,2,6-trimethyl-1-azacyclodeca-3,7,8,10-tetraene |
| SMILES | CC.CC1C=C=C/C=N\C(C)(C)/C=C/C1 |
| InChI | InChI=1S/C12H17N.C2H6/c1-11-7-4-5-10-13-12(2,3)9-6-8-11;1-2/h5-7,9-11H,8H2,1-3H3;1-2H3/b9-6+,13-10-; |
| InChIKey | UIESHUBWJYYAQV-RADWMBCZSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|