C25H20ClN5O2S — CID 143702696
1-(4-aminosulfanylphenyl)-3-(4-chlorophenyl)-4-(3-pyridazin-3-yloxyphenyl)imidazolidin-2-one (PubChem CID 143702696) has the molecular formula C25H20ClN5O2S and a molecular weight of 489.99 g/mol. Its IUPAC name is 1-(4-aminosulfanylphenyl)-3-(4-chlorophenyl)-4-(3-pyridazin-3-yloxyphenyl)imidazolidin-2-one.
| Compound Name | 1-(4-aminosulfanylphenyl)-3-(4-chlorophenyl)-4-(3-pyridazin-3-yloxyphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 143702696 |
| Molecular Formula | C25H20ClN5O2S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 1-(4-aminosulfanylphenyl)-3-(4-chlorophenyl)-4-(3-pyridazin-3-yloxyphenyl)imidazolidin-2-one |
| SMILES | NSc1ccc(N2CC(c3cccc(Oc4cccnn4)c3)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H20ClN5O2S/c26-18-6-8-20(9-7-18)31-23(16-30(25(31)32)19-10-12-22(34-27)13-11-19)17-3-1-4-21(15-17)33-24-5-2-14-28-29-24/h1-15,23H,16,27H2 |
| InChIKey | NWUHHSFLACRQAF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|