C23H19ClF2N2O2 — CID 145417086
3-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1-(4-methylphenyl)imidazolidin-2-one (PubChem CID 145417086) has the molecular formula C23H19ClF2N2O2 and a molecular weight of 428.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1-(4-methylphenyl)imidazolidin-2-one.
| Compound Name | 3-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1-(4-methylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 145417086 |
| Molecular Formula | C23H19ClF2N2O2 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 3-(4-chlorophenyl)-4-[3-(difluoromethoxy)phenyl]-1-(4-methylphenyl)imidazolidin-2-one |
| SMILES | Cc1ccc(N2CC(c3cccc(OC(F)F)c3)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H19ClF2N2O2/c1-15-5-9-18(10-6-15)27-14-21(16-3-2-4-20(13-16)30-22(25)26)28(23(27)29)19-11-7-17(24)8-12-19/h2-13,21-22H,14H2,1H3 |
| InChIKey | NTAQUGIDKCFQFS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |