C17H13ClF3NO2 — CID 70821754
(5R)-1-(4-chlorophenyl)-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 70821754) has the molecular formula C17H13ClF3NO2 and a molecular weight of 355.74 g/mol. Its IUPAC name is (5R)-1-(4-chlorophenyl)-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-(4-chlorophenyl)-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 70821754 |
| Molecular Formula | C17H13ClF3NO2 |
| Molecular Weight | 355.74 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (5R)-1-(4-chlorophenyl)-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](c2cccc(OC(F)(F)F)c2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClF3NO2/c18-12-4-6-13(7-5-12)22-15(8-9-16(22)23)11-2-1-3-14(10-11)24-17(19,20)21/h1-7,10,15H,8-9H2/t15-/m1/s1 |
| InChIKey | JKAMGPKJUNPVCR-OAHLLOKOSA-N |
| XLogP | 5.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |