C26H16F10N2O4 — CID 123998416
5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]iminopyrrolidin-2-one (PubChem CID 123998416) has the molecular formula C26H16F10N2O4 and a molecular weight of 610.40 g/mol. Its IUPAC name is 5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]iminopyrrolidin-2-one.
| Compound Name | 5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]iminopyrrolidin-2-one |
|---|---|
| PubChem CID | 123998416 |
| Molecular Formula | C26H16F10N2O4 |
| Molecular Weight | 610.40 g/mol |
| Exact Mass | 610.10 |
| IUPAC Name | 5-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1-[4-(trifluoromethoxy)phenyl]-3-[4-(trifluoromethoxy)phenyl]iminopyrrolidin-2-one |
| SMILES | O=C1/C(=N/c2ccc(OC(F)(F)F)cc2)CC(c2cccc(OC(F)(F)C(F)F)c2)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H16F10N2O4/c27-23(28)24(29,30)40-19-3-1-2-14(12-19)21-13-20(37-15-4-8-17(9-5-15)41-25(31,32)33)22(39)38(21)16-6-10-18(11-7-16)42-26(34,35)36/h1-12,21,23H,13H2/b37-20+ |
| InChIKey | NUWVLDASGCJEAL-HASSKWOGSA-N |
| XLogP | 7.97 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.40 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|