C25H21F3N2O2 — CID 90760164
1-(4-methylphenyl)-3-(4-methylphenyl)imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 90760164) has the molecular formula C25H21F3N2O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(4-methylphenyl)imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 1-(4-methylphenyl)-3-(4-methylphenyl)imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 90760164 |
| Molecular Formula | C25H21F3N2O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-(4-methylphenyl)-3-(4-methylphenyl)imino-5-[3-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(/N=C2\CC(c3cccc(OC(F)(F)F)c3)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H21F3N2O2/c1-16-6-10-19(11-7-16)29-22-15-23(18-4-3-5-21(14-18)32-25(26,27)28)30(24(22)31)20-12-8-17(2)9-13-20/h3-14,23H,15H2,1-2H3/b29-22+ |
| InChIKey | GOVIMTMXFWFPCG-QUPMIFSKSA-N |
| XLogP | 6.45 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|